Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Lithium Bromide, MP Biomedicals™
CAS: 7550-35-8 Molecular Formula: BrLi Molecular Weight (g/mol): 86.84 InChI Key: AMXOYNBUYSYVKV-UHFFFAOYSA-M IUPAC Name: lithium(1+) bromide SMILES: [Li+].[Br-]
| CAS | 7550-35-8 |
|---|---|
| Molecular Weight (g/mol) | 86.84 |
| SMILES | [Li+].[Br-] |
| IUPAC Name | lithium(1+) bromide |
| InChI Key | AMXOYNBUYSYVKV-UHFFFAOYSA-M |
| Molecular Formula | BrLi |
Aluminum acetate, 90%, basic
CAS: 142-03-0 Molecular Formula: C4H7AlO5 Molecular Weight (g/mol): 162.08 MDL Number: MFCD00008688 InChI Key: HQQUTGFAWJNQIP-UHFFFAOYSA-K Synonym: aluminum acetate, basic hydrate,c4h7alo5.h2o,aluminum diacetate hydrate PubChem CID: 18502856 IUPAC Name: (acetyloxy)(hydroxy)alumanyl acetate SMILES: CC(=O)O[Al](O)OC(C)=O
| PubChem CID | 18502856 |
|---|---|
| CAS | 142-03-0 |
| Molecular Weight (g/mol) | 162.08 |
| MDL Number | MFCD00008688 |
| SMILES | CC(=O)O[Al](O)OC(C)=O |
| Synonym | aluminum acetate, basic hydrate,c4h7alo5.h2o,aluminum diacetate hydrate |
| IUPAC Name | (acetyloxy)(hydroxy)alumanyl acetate |
| InChI Key | HQQUTGFAWJNQIP-UHFFFAOYSA-K |
| Molecular Formula | C4H7AlO5 |
Gold, 99.99%, (trace metal basis), shot
CAS: 7440-57-5 Molecular Formula: Au Molecular Weight (g/mol): 196.97 MDL Number: MFCD00003436 InChI Key: PCHJSUWPFVWCPO-UHFFFAOYSA-N Synonym: colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 PubChem CID: 23985 ChEBI: CHEBI:30050 IUPAC Name: gold SMILES: [Au]
| PubChem CID | 23985 |
|---|---|
| CAS | 7440-57-5 |
| Molecular Weight (g/mol) | 196.97 |
| ChEBI | CHEBI:30050 |
| MDL Number | MFCD00003436 |
| SMILES | [Au] |
| Synonym | colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 |
| IUPAC Name | gold |
| InChI Key | PCHJSUWPFVWCPO-UHFFFAOYSA-N |
| Molecular Formula | Au |
Bis(3,5,3',5'-dimethoxydibenzylideneacetone)palladium(0), 96%
CAS: 811862-77-8 Molecular Formula: C42H44O10Pd Molecular Weight (g/mol): 815.22 MDL Number: MFCD07369799 InChI Key: RTGAJOPJZJDWAX-UHFFFAOYSA-N Synonym: bis 3,5,3',5'-dimethoxydibenzylideneacetone palladium 0,pd dmdba 2,bis 353'5'-dimethoxydibenzylideneace,bis 3,5,3',5'-dimethoxydibenzylideneacetone palladium PubChem CID: 24777333 IUPAC Name: 1,5-bis(3,5-dimethoxyphenyl)penta-1,4-dien-3-one;palladium SMILES: [Pd].COC1=CC(C=CC(=O)C=CC2=CC(OC)=CC(OC)=C2)=CC(OC)=C1.COC1=CC(C=CC(=O)C=CC2=CC(OC)=CC(OC)=C2)=CC(OC)=C1
| PubChem CID | 24777333 |
|---|---|
| CAS | 811862-77-8 |
| Molecular Weight (g/mol) | 815.22 |
| MDL Number | MFCD07369799 |
| SMILES | [Pd].COC1=CC(C=CC(=O)C=CC2=CC(OC)=CC(OC)=C2)=CC(OC)=C1.COC1=CC(C=CC(=O)C=CC2=CC(OC)=CC(OC)=C2)=CC(OC)=C1 |
| Synonym | bis 3,5,3',5'-dimethoxydibenzylideneacetone palladium 0,pd dmdba 2,bis 353'5'-dimethoxydibenzylideneace,bis 3,5,3',5'-dimethoxydibenzylideneacetone palladium |
| IUPAC Name | 1,5-bis(3,5-dimethoxyphenyl)penta-1,4-dien-3-one;palladium |
| InChI Key | RTGAJOPJZJDWAX-UHFFFAOYSA-N |
| Molecular Formula | C42H44O10Pd |
Dextran sulfate sodium salt, approx. M.W. 500,000
CAS: 9011-18-1 Molecular Formula: (C6H7O5)m(C6H7O5)n Molecular Weight (g/mol): 40,000 MDL Number: MFCD00081551 InChI Key: BLFLLBZGZJTVJG-UHFFFAOYSA-N Synonym: benzocaine,ethyl aminobenzoate,ethyl p-aminobenzoate,americaine,anesthesin,anaesthesin,ethoform,norcaine,orthesin,parathesin PubChem CID: 2337 ChEBI: CHEBI:116735 IUPAC Name: Dextran sulfate sodium salt SMILES: *-OC[C@H]1O[C@H](OC[C@H]2O[C@H](-*)[C@H](O[*])[C@@H](O[*])[C@@H]2O[*])[C@H](O[*])[C@@H](O-*)[C@@H]1O[*]
| PubChem CID | 2337 |
|---|---|
| CAS | 9011-18-1 |
| Molecular Weight (g/mol) | 40,000 |
| ChEBI | CHEBI:116735 |
| MDL Number | MFCD00081551 |
| SMILES | *-OC[C@H]1O[C@H](OC[C@H]2O[C@H](-*)[C@H](O[*])[C@@H](O[*])[C@@H]2O[*])[C@H](O[*])[C@@H](O-*)[C@@H]1O[*] |
| Synonym | benzocaine,ethyl aminobenzoate,ethyl p-aminobenzoate,americaine,anesthesin,anaesthesin,ethoform,norcaine,orthesin,parathesin |
| IUPAC Name | Dextran sulfate sodium salt |
| InChI Key | BLFLLBZGZJTVJG-UHFFFAOYSA-N |
| Molecular Formula | (C6H7O5)m(C6H7O5)n |
Lead(II) perchlorate trihydrate, ACS reagent
CAS: 13453-62-8 Molecular Formula: Cl2H6O11Pb Molecular Weight (g/mol): 460.10 MDL Number: MFCD00149817 InChI Key: KKGGEAQRICYXNM-UHFFFAOYSA-L Synonym: lead ii perchlorate trihydrate,acmc-20aknd,2clo4.pb.3h2o,lead perchlorate 3h2o,lead ii perchlorate, trihydrate,lead perchlorate, trihydrate, reagent acs,lead ii perchlorate trihydrate, acs reagent PubChem CID: 25021834 IUPAC Name: lead(2+);diperchlorate;trihydrate SMILES: O.O.O.[Pb++].[O-][Cl](=O)(=O)=O.[O-][Cl](=O)(=O)=O
| PubChem CID | 25021834 |
|---|---|
| CAS | 13453-62-8 |
| Molecular Weight (g/mol) | 460.10 |
| MDL Number | MFCD00149817 |
| SMILES | O.O.O.[Pb++].[O-][Cl](=O)(=O)=O.[O-][Cl](=O)(=O)=O |
| Synonym | lead ii perchlorate trihydrate,acmc-20aknd,2clo4.pb.3h2o,lead perchlorate 3h2o,lead ii perchlorate, trihydrate,lead perchlorate, trihydrate, reagent acs,lead ii perchlorate trihydrate, acs reagent |
| IUPAC Name | lead(2+);diperchlorate;trihydrate |
| InChI Key | KKGGEAQRICYXNM-UHFFFAOYSA-L |
| Molecular Formula | Cl2H6O11Pb |
Mercury(I) nitrate dihydrate, ACS reagent, 9th edition
CAS: 7782-86-7 Molecular Formula: H4Hg2N2O8 Molecular Weight (g/mol): 561.22 InChI Key: LSABZDVKJBWCBE-UHFFFAOYSA-N IUPAC Name: dimercury(1+) dihydrate dinitrate SMILES: O.O.[Hg+].[Hg+].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| CAS | 7782-86-7 |
|---|---|
| Molecular Weight (g/mol) | 561.22 |
| SMILES | O.O.[Hg+].[Hg+].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| IUPAC Name | dimercury(1+) dihydrate dinitrate |
| InChI Key | LSABZDVKJBWCBE-UHFFFAOYSA-N |
| Molecular Formula | H4Hg2N2O8 |
Calcium stearate, 5.9 to 7.1% (Ca), powder, Thermo Scientific Chemicals
CAS: 1592-23-0 Molecular Formula: C36H70CaO4 Molecular Weight (g/mol): 607.02 MDL Number: MFCD00036390 InChI Key: CJZGTCYPCWQAJB-UHFFFAOYSA-L Synonym: calcium stearate,calcium octadecanoate,flexichem,calcium distearate,octadecanoic acid, calcium salt,aquacal,calstar,flexichem cs,stavinor 30,stearates PubChem CID: 15324 IUPAC Name: calcium;octadecanoate SMILES: CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCCCCCCC(=O)[O-].[Ca+2]
| PubChem CID | 15324 |
|---|---|
| CAS | 1592-23-0 |
| Molecular Weight (g/mol) | 607.02 |
| MDL Number | MFCD00036390 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCCCCCCC(=O)[O-].[Ca+2] |
| Synonym | calcium stearate,calcium octadecanoate,flexichem,calcium distearate,octadecanoic acid, calcium salt,aquacal,calstar,flexichem cs,stavinor 30,stearates |
| IUPAC Name | calcium;octadecanoate |
| InChI Key | CJZGTCYPCWQAJB-UHFFFAOYSA-L |
| Molecular Formula | C36H70CaO4 |
Lithium diphenylphosphide, 0.5M solution in THF, AcroSeal™
CAS: 65567-06-8 Molecular Formula: C12H10LiP Molecular Weight (g/mol): 192.13 MDL Number: MFCD00046054 InChI Key: WKUYEGHEUWHKIU-UHFFFAOYSA-N Synonym: lithiodiphenylphosphine,lithium diphenylphosphide solution,diphenylphosphine lithium salt,lithium diphenylphosphanide,lipph2,lithiodiphenyl phosphide,lithium diphenylphosphine,diphenylphosphino lithium,diphenyl lithium phosphide PubChem CID: 3478053 IUPAC Name: lithiodiphenylphosphane SMILES: [Li]P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 3478053 |
|---|---|
| CAS | 65567-06-8 |
| Molecular Weight (g/mol) | 192.13 |
| MDL Number | MFCD00046054 |
| SMILES | [Li]P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | lithiodiphenylphosphine,lithium diphenylphosphide solution,diphenylphosphine lithium salt,lithium diphenylphosphanide,lipph2,lithiodiphenyl phosphide,lithium diphenylphosphine,diphenylphosphino lithium,diphenyl lithium phosphide |
| IUPAC Name | lithiodiphenylphosphane |
| InChI Key | WKUYEGHEUWHKIU-UHFFFAOYSA-N |
| Molecular Formula | C12H10LiP |
| Linear Formula | SbCl5 |
|---|---|
| Molecular Weight (g/mol) | 299.02 |
| Color | Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Antimony(V)-chloride |
| SMILES | Cl[Sb](Cl)(Cl)(Cl)Cl |
| Merck Index | 15,686 |
| InChI Key | VMPVEPPRYRXYNP-UHFFFAOYSA-I |
| Density | 1.4420g/mL |
| PubChem CID | 24294 |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: Rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| MDL Number | MFCD00011213 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Suspected of causing cancer. May cause respiratory irritation. May cause drowsiness or dizziness. Toxic to aquatic life with long lasting effects. |
| Packaging | AcroSeal™ Glass Bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | antimony v chloride,antimony pentachloride,pentachloroantimony,antimony perchloride,antimony chloride sbcl5,antimonpentachlorid,antimoonpentachloride,perchlorure d'antimoine,pentachlorure d'antimoine,antimonpentachlorid german |
| IUPAC Name | pentachloro-$l^{5}-stibane |
| Molecular Formula | Cl5Sb |
| EINECS Number | 231-601-8 |
| Formula Weight | 299.01 |
| Specific Gravity | 1.442 |
Hydrogen hexachloroplatinate(IV) hydrate, 99.9%, (trace metal basis), 38 to 40% Pt
CAS: 26023-84-7 Molecular Formula: Cl6H2Pt Molecular Weight (g/mol): 409.80 MDL Number: MFCD00149909 InChI Key: ZKOQTCCVSRSECD-UHFFFAOYSA-J Synonym: Hexachloroplatinic acid hexahydrate,Platinic chloride hexahydrate IUPAC Name: dihydrogen hexachloroplatinumtetrakis(ylium) SMILES: [H+].[H+].Cl[Pt+4](Cl)(Cl)(Cl)(Cl)Cl
| CAS | 26023-84-7 |
|---|---|
| Molecular Weight (g/mol) | 409.80 |
| MDL Number | MFCD00149909 |
| SMILES | [H+].[H+].Cl[Pt+4](Cl)(Cl)(Cl)(Cl)Cl |
| Synonym | Hexachloroplatinic acid hexahydrate,Platinic chloride hexahydrate |
| IUPAC Name | dihydrogen hexachloroplatinumtetrakis(ylium) |
| InChI Key | ZKOQTCCVSRSECD-UHFFFAOYSA-J |
| Molecular Formula | Cl6H2Pt |
Boric anhydride, 99.98% trace metals basis, MilliporeSigma™ Supelco™
MDL Number: MFCD00011315 Synonym: Boron trioxide
| MDL Number | MFCD00011315 |
|---|---|
| Synonym | Boron trioxide |
Calcium iodate, pure
CAS: 7789-80-2 Molecular Formula: CaI2O6 Molecular Weight (g/mol): 389.89 InChI Key: UHWJJLGTKIWIJO-UHFFFAOYSA-L Synonym: calcium iodate,lautarite,calcium diiodate,unii-l8mn4y57br,l8mn4y57br,iodic acid hio3 , calcium salt 2:1,autarite,iodic acid, calcium salt,calcium iodate ca io3 2,hsdb 986 PubChem CID: 24619 IUPAC Name: calcium;diiodate SMILES: [O-]I(=O)=O.[O-]I(=O)=O.[Ca+2]
| PubChem CID | 24619 |
|---|---|
| CAS | 7789-80-2 |
| Molecular Weight (g/mol) | 389.89 |
| SMILES | [O-]I(=O)=O.[O-]I(=O)=O.[Ca+2] |
| Synonym | calcium iodate,lautarite,calcium diiodate,unii-l8mn4y57br,l8mn4y57br,iodic acid hio3 , calcium salt 2:1,autarite,iodic acid, calcium salt,calcium iodate ca io3 2,hsdb 986 |
| IUPAC Name | calcium;diiodate |
| InChI Key | UHWJJLGTKIWIJO-UHFFFAOYSA-L |
| Molecular Formula | CaI2O6 |
Erbium(III) chloride, ultra dry, 99.9% (REO)
CAS: 10138-41-7 Molecular Formula: Cl3Er Molecular Weight (g/mol): 273.609 MDL Number: MFCD00010989 InChI Key: HDGGAKOVUDZYES-UHFFFAOYSA-K Synonym: erbium chloride,erbium trichloride,erbium chloride ercl3,ercl3,erbium iii chloride, anhydrous,erbium iii chloride, ultra dry,erbium iii chloride hexahydrate,erbium iii chloride, anhydrous, ?ercl3,erbium iii chloride, anhydrous, powder trace metals basis,erbium iii chloride, anhydrous, beads,-10 mesh trace metals basis PubChem CID: 66277 IUPAC Name: trichloroerbium SMILES: Cl[Er](Cl)Cl
| PubChem CID | 66277 |
|---|---|
| CAS | 10138-41-7 |
| Molecular Weight (g/mol) | 273.609 |
| MDL Number | MFCD00010989 |
| SMILES | Cl[Er](Cl)Cl |
| Synonym | erbium chloride,erbium trichloride,erbium chloride ercl3,ercl3,erbium iii chloride, anhydrous,erbium iii chloride, ultra dry,erbium iii chloride hexahydrate,erbium iii chloride, anhydrous, ?ercl3,erbium iii chloride, anhydrous, powder trace metals basis,erbium iii chloride, anhydrous, beads,-10 mesh trace metals basis |
| IUPAC Name | trichloroerbium |
| InChI Key | HDGGAKOVUDZYES-UHFFFAOYSA-K |
| Molecular Formula | Cl3Er |
Sulfuryl chloride, 1.0M solution in dichloromethane, AcroSeal™
CAS: 7791-25-5 | Cl2O2S | 134.96 g/mol
| Linear Formula | SO2Cl2 |
|---|---|
| Molecular Weight (g/mol) | 134.96 |
| ChEBI | CHEBI:29291 |
| Chemical Name or Material | Sulfuryl chloride |
| SMILES | ClS(Cl)(=O)=O |
| Merck Index | 15, 9110 |
| InChI Key | YBBRCQOCSYXUOC-UHFFFAOYSA-N |
| Density | 1.3520g/mL |
| Appearance | Clear pale yellow solution |
| PubChem CID | 24648 |
| Name Note | 1.0M Solution in Dichloromethane |
| Concentration or Composition (by Analyte or Components) | 1M, exact strength on the certificate of analysis |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| MDL Number | MFCD00011451 |
| Health Hazard 2 | GHS H Statement Suspected of causing cancer. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. Toxic if inhaled. Reacts violently with water. |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | sulfuryl chloride,sulfonyl chloride,sulphuryl dichloride,sulphuryl chloride,sulfonyl dichloride,sulfuric dichloride,sulfuric oxychloride,sulfurylchlorid,caswell no. 816,sulfurylchloride |
| IUPAC Name | sulfuryl dichloride |
| Molecular Formula | Cl2O2S |
| EINECS Number | 232-245-6 |
| Formula Weight | 134.97 |
| Specific Gravity | 1.352 |